ChemNet > CAS > 403479-30-1 1-Benzyl-2-(methylsulfanyl)-1H-imidazole- 5-carboxylic acid
403479-30-1 1-Benzyl-2-(methylsulfanyl)-1H-imidazole- 5-carboxylic acid
produktnavn |
1-Benzyl-2-(methylsulfanyl)-1H-imidazole- 5-carboxylic acid |
Synonymer |
1-benzyl-2-(methylsulfanyl)-1H-imidazole-5-carboxylic acid |
Molekylær Formel |
C12H12N2O2S |
Molekylvekt |
248.3009 |
InChI |
InChI=1/C12H12N2O2S/c1-17-12-13-7-10(11(15)16)14(12)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,15,16) |
CAS-nummer |
403479-30-1 |
Molecular Structure |
|
Tetthet |
1.28g/cm3 |
Kokepunkt |
506.2°C at 760 mmHg |
Brytningsindeks |
1.636 |
Flammepunktet |
260°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S36:Wear suitable protective clothing.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|